About 4-butyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one
4-butyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 11355850) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-butyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one.
Analyze 4-butyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one?
The IUPAC name of 4-butyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one (CID 11355850) is 4-butyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one.
What is the SMILES notation for 4-butyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one?
The canonical SMILES for 4-butyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one is CCCCC1=C2COCC2CC1=O.
What is the InChIKey of 4-butyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one?
The InChIKey is DDHABZTXHWFVQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-2-3-4-9-10-7-13-6-8(10)5-11(9)12/h8H,2-7H2,1H3.
What are the key properties of 4-butyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one?
4-butyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one has a molecular weight of 180.25 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one is sourced from PubChem (CID 11355850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).