C12H15NO2 — CID 11356190
1-(3-methyl-5-phenyl-1,2-oxazolidin-2-yl)ethanone (PubChem CID 11356190) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-(3-methyl-5-phenyl-1,2-oxazolidin-2-yl)ethanone.
| Compound Name | 1-(3-methyl-5-phenyl-1,2-oxazolidin-2-yl)ethanone |
|---|---|
| PubChem CID | 11356190 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-(3-methyl-5-phenyl-1,2-oxazolidin-2-yl)ethanone |
| SMILES | CC(=O)N1OC(c2ccccc2)CC1C |
| InChI | InChI=1S/C12H15NO2/c1-9-8-12(15-13(9)10(2)14)11-6-4-3-5-7-11/h3-7,9,12H,8H2,1-2H3 |
| InChIKey | OXAJQPICYRGOIF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |