C11H13ClN2O — CID 11356542
4-chloro-5-(3,3-dimethylbut-1-ynyl)-2-methylpyridazin-3-one (PubChem CID 11356542) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is 4-chloro-5-(3,3-dimethylbut-1-ynyl)-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-5-(3,3-dimethylbut-1-ynyl)-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 11356542 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 4-chloro-5-(3,3-dimethylbut-1-ynyl)-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(C#CC(C)(C)C)c(Cl)c1=O |
| InChI | InChI=1S/C11H13ClN2O/c1-11(2,3)6-5-8-7-13-14(4)10(15)9(8)12/h7H,1-4H3 |
| InChIKey | PKPSAEUDYGYFFL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|