C10H13N5O3 — CID 11357172
methyl 2-[methyl-(9-methyl-8-oxo-7H-purin-6-yl)amino]acetate (PubChem CID 11357172) has the molecular formula C10H13N5O3 and a molecular weight of 251.25 g/mol. Its IUPAC name is methyl 2-[methyl-(9-methyl-8-oxo-7H-purin-6-yl)amino]acetate.
| Compound Name | methyl 2-[methyl-(9-methyl-8-oxo-7H-purin-6-yl)amino]acetate |
|---|---|
| PubChem CID | 11357172 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | methyl 2-[methyl-(9-methyl-8-oxo-7H-purin-6-yl)amino]acetate |
| SMILES | COC(=O)CN(C)c1ncnc2c1[nH]c(=O)n2C |
| InChI | InChI=1S/C10H13N5O3/c1-14(4-6(16)18-3)8-7-9(12-5-11-8)15(2)10(17)13-7/h5H,4H2,1-3H3,(H,13,17) |
| InChIKey | RTTBMMJEDVTOQH-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |