C17H28O2 — CID 11357550
(1R,2S,3R,5R)-1-[(2R)-but-3-en-2-yl]-2-methyl-5-prop-1-en-2-yl-2-prop-2-enylcyclohexane-1,3-diol (PubChem CID 11357550) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (1R,2S,3R,5R)-1-[(2R)-but-3-en-2-yl]-2-methyl-5-prop-1-en-2-yl-2-prop-2-enylcyclohexane-1,3-diol.
| Compound Name | (1R,2S,3R,5R)-1-[(2R)-but-3-en-2-yl]-2-methyl-5-prop-1-en-2-yl-2-prop-2-enylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 11357550 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (1R,2S,3R,5R)-1-[(2R)-but-3-en-2-yl]-2-methyl-5-prop-1-en-2-yl-2-prop-2-enylcyclohexane-1,3-diol |
| SMILES | C=CC[C@@]1(C)[C@H](O)C[C@@H](C(=C)C)C[C@@]1(O)[C@H](C)C=C |
| InChI | InChI=1S/C17H28O2/c1-7-9-16(6)15(18)10-14(12(3)4)11-17(16,19)13(5)8-2/h7-8,13-15,18-19H,1-3,9-11H2,4-6H3/t13-,14-,15-,16+,17-/m1/s1 |
| InChIKey | QLKVRMOZJQRMRW-OVYGPGRDSA-N |
| XLogP | 3.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|