C15H13N3O2 — CID 11357628
3-(2-phenylethyl)-1H-pyrido[3,2-d]pyrimidine-2,4-dione (PubChem CID 11357628) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-(2-phenylethyl)-1H-pyrido[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-(2-phenylethyl)-1H-pyrido[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11357628 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-(2-phenylethyl)-1H-pyrido[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2cccnc2c(=O)n1CCc1ccccc1 |
| InChI | InChI=1S/C15H13N3O2/c19-14-13-12(7-4-9-16-13)17-15(20)18(14)10-8-11-5-2-1-3-6-11/h1-7,9H,8,10H2,(H,17,20) |
| InChIKey | LSYPPHGRTYKWOC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |