C15H18F3N — CID 11357688
N-benzyl-1,1,1-trifluoro-N-prop-2-enylpent-4-en-2-amine (PubChem CID 11357688) has the molecular formula C15H18F3N and a molecular weight of 269.31 g/mol. Its IUPAC name is N-benzyl-1,1,1-trifluoro-N-prop-2-enylpent-4-en-2-amine.
| Compound Name | N-benzyl-1,1,1-trifluoro-N-prop-2-enylpent-4-en-2-amine |
|---|---|
| PubChem CID | 11357688 |
| Molecular Formula | C15H18F3N |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-benzyl-1,1,1-trifluoro-N-prop-2-enylpent-4-en-2-amine |
| SMILES | C=CCC(N(CC=C)Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H18F3N/c1-3-8-14(15(16,17)18)19(11-4-2)12-13-9-6-5-7-10-13/h3-7,9-10,14H,1-2,8,11-12H2 |
| InChIKey | BQSLPJQHYMOLGU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|