C18H22O4 — CID 11358549
(E)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-1-(4-methoxyphenyl)prop-2-en-1-one (PubChem CID 11358549) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (E)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-1-(4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-1-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 11358549 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (E)-3-[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]-1-(4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/[C@H]2COC3(CCCCC3)O2)cc1 |
| InChI | InChI=1S/C18H22O4/c1-20-15-7-5-14(6-8-15)17(19)10-9-16-13-21-18(22-16)11-3-2-4-12-18/h5-10,16H,2-4,11-13H2,1H3/b10-9+/t16-/m0/s1 |
| InChIKey | MBVHEJIIMNYUHE-SCOAYWHSSA-N |
| XLogP | 3.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|