C17H21NO3S — CID 11359085
(3aR,8Z,9aS)-2-(4-methylphenyl)sulfonyl-3,3a,4,6,7,9a-hexahydro-1H-cycloocta[c]pyrrol-5-one (PubChem CID 11359085) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is (3aR,8Z,9aS)-2-(4-methylphenyl)sulfonyl-3,3a,4,6,7,9a-hexahydro-1H-cycloocta[c]pyrrol-5-one.
| Compound Name | (3aR,8Z,9aS)-2-(4-methylphenyl)sulfonyl-3,3a,4,6,7,9a-hexahydro-1H-cycloocta[c]pyrrol-5-one |
|---|---|
| PubChem CID | 11359085 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (3aR,8Z,9aS)-2-(4-methylphenyl)sulfonyl-3,3a,4,6,7,9a-hexahydro-1H-cycloocta[c]pyrrol-5-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3CC(=O)CC/C=C\[C@@H]3C2)cc1 |
| InChI | InChI=1S/C17H21NO3S/c1-13-6-8-17(9-7-13)22(20,21)18-11-14-4-2-3-5-16(19)10-15(14)12-18/h2,4,6-9,14-15H,3,5,10-12H2,1H3/b4-2-/t14-,15+/m1/s1 |
| InChIKey | SNJDMUGYQCAUBJ-JYIXZZHJSA-N |
| XLogP | 2.54 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|