C19H30O4 — CID 11359171
[(1S,3E)-4-methyl-1-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]hexa-3,5-dienyl] (E)-4-methylpent-2-enoate (PubChem CID 11359171) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is [(1S,3E)-4-methyl-1-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]hexa-3,5-dienyl] (E)-4-methylpent-2-enoate.
| Compound Name | [(1S,3E)-4-methyl-1-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]hexa-3,5-dienyl] (E)-4-methylpent-2-enoate |
|---|---|
| PubChem CID | 11359171 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | [(1S,3E)-4-methyl-1-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]hexa-3,5-dienyl] (E)-4-methylpent-2-enoate |
| SMILES | C=C/C(C)=C/C[C@H](OC(=O)/C=C/C(C)C)[C@]1(C)COC(C)(C)O1 |
| InChI | InChI=1S/C19H30O4/c1-8-15(4)10-11-16(22-17(20)12-9-14(2)3)19(7)13-21-18(5,6)23-19/h8-10,12,14,16H,1,11,13H2,2-7H3/b12-9+,15-10+/t16-,19-/m0/s1 |
| InChIKey | TZZWAJDJKVPGIA-LFBYUSCISA-N |
| XLogP | 4.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|