C19H29IO6 — CID 11386070
6-O-[(E,2S,3R)-5-iodo-3-methyl-1-(2-methyl-1,3-dioxolan-2-yl)hex-4-en-2-yl] 1-O-methyl (E,4S)-4-methylhex-2-enedioate (PubChem CID 11386070) has the molecular formula C19H29IO6 and a molecular weight of 480.34 g/mol. Its IUPAC name is 6-O-[(E,2S,3R)-5-iodo-3-methyl-1-(2-methyl-1,3-dioxolan-2-yl)hex-4-en-2-yl] 1-O-methyl (E,4S)-4-methylhex-2-enedioate.
| Compound Name | 6-O-[(E,2S,3R)-5-iodo-3-methyl-1-(2-methyl-1,3-dioxolan-2-yl)hex-4-en-2-yl] 1-O-methyl (E,4S)-4-methylhex-2-enedioate |
|---|---|
| PubChem CID | 11386070 |
| Molecular Formula | C19H29IO6 |
| Molecular Weight | 480.34 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 6-O-[(E,2S,3R)-5-iodo-3-methyl-1-(2-methyl-1,3-dioxolan-2-yl)hex-4-en-2-yl] 1-O-methyl (E,4S)-4-methylhex-2-enedioate |
| SMILES | COC(=O)/C=C/[C@@H](C)CC(=O)O[C@@H](CC1(C)OCCO1)[C@H](C)/C=C(\C)I |
| InChI | InChI=1S/C19H29IO6/c1-13(6-7-17(21)23-5)10-18(22)26-16(14(2)11-15(3)20)12-19(4)24-8-9-25-19/h6-7,11,13-14,16H,8-10,12H2,1-5H3/b7-6+,15-11+/t13-,14-,16+/m1/s1 |
| InChIKey | PPQRQCRSJWDKIG-ZETUARJFSA-N |
| XLogP | 3.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|