C17H26O4 — CID 15945942
[(2R)-hept-6-en-2-yl] (E)-3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (PubChem CID 15945942) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is [(2R)-hept-6-en-2-yl] (E)-3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate.
| Compound Name | [(2R)-hept-6-en-2-yl] (E)-3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 15945942 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [(2R)-hept-6-en-2-yl] (E)-3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate |
| SMILES | C=CCCC[C@@H](C)OC(=O)/C=C/[C@H]1OC(C)(C)O[C@@H]1C=C |
| InChI | InChI=1S/C17H26O4/c1-6-8-9-10-13(3)19-16(18)12-11-15-14(7-2)20-17(4,5)21-15/h6-7,11-15H,1-2,8-10H2,3-5H3/b12-11+/t13-,14-,15-/m1/s1 |
| InChIKey | OGBKJKDNYDGVGP-KGPRGJLFSA-N |
| XLogP | 3.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|