C14H23IO4 — CID 10249303
ethyl (2E)-2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-6-iodohexanoate (PubChem CID 10249303) has the molecular formula C14H23IO4 and a molecular weight of 382.24 g/mol. Its IUPAC name is ethyl (2E)-2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-6-iodohexanoate.
| Compound Name | ethyl (2E)-2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-6-iodohexanoate |
|---|---|
| PubChem CID | 10249303 |
| Molecular Formula | C14H23IO4 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | ethyl (2E)-2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylidene]-6-iodohexanoate |
| SMILES | CCOC(=O)/C(=C/[C@H]1COC(C)(C)O1)CCCCI |
| InChI | InChI=1S/C14H23IO4/c1-4-17-13(16)11(7-5-6-8-15)9-12-10-18-14(2,3)19-12/h9,12H,4-8,10H2,1-3H3/b11-9+/t12-/m0/s1 |
| InChIKey | KMPGRTDXUGNCRF-ZKQHCESOSA-N |
| XLogP | 3.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|