C16H23IO4 — CID 11718390
2-[(Z)-3-iodo-2-methylprop-2-enyl]-4-[(E)-5-(methoxymethoxy)-4-methylpent-3-enyl]-2H-furan-5-one (PubChem CID 11718390) has the molecular formula C16H23IO4 and a molecular weight of 406.26 g/mol. Its IUPAC name is 2-[(Z)-3-iodo-2-methylprop-2-enyl]-4-[(E)-5-(methoxymethoxy)-4-methylpent-3-enyl]-2H-furan-5-one.
| Compound Name | 2-[(Z)-3-iodo-2-methylprop-2-enyl]-4-[(E)-5-(methoxymethoxy)-4-methylpent-3-enyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 11718390 |
| Molecular Formula | C16H23IO4 |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 2-[(Z)-3-iodo-2-methylprop-2-enyl]-4-[(E)-5-(methoxymethoxy)-4-methylpent-3-enyl]-2H-furan-5-one |
| SMILES | COCOC/C(C)=C/CCC1=CC(C/C(C)=C\I)OC1=O |
| InChI | InChI=1S/C16H23IO4/c1-12(10-20-11-19-3)5-4-6-14-8-15(21-16(14)18)7-13(2)9-17/h5,8-9,15H,4,6-7,10-11H2,1-3H3/b12-5+,13-9- |
| InChIKey | SUFIAMASCQGNDH-XQGTVNQBSA-N |
| XLogP | 3.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|