C14H17IO3 — CID 134972545
(E)-5-[2-[(Z)-3-iodo-2-methylprop-2-enyl]-5-oxo-2H-furan-4-yl]-2-methylpent-2-enal (PubChem CID 134972545) has the molecular formula C14H17IO3 and a molecular weight of 360.19 g/mol. Its IUPAC name is (E)-5-[2-[(Z)-3-iodo-2-methylprop-2-enyl]-5-oxo-2H-furan-4-yl]-2-methylpent-2-enal.
| Compound Name | (E)-5-[2-[(Z)-3-iodo-2-methylprop-2-enyl]-5-oxo-2H-furan-4-yl]-2-methylpent-2-enal |
|---|---|
| PubChem CID | 134972545 |
| Molecular Formula | C14H17IO3 |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | (E)-5-[2-[(Z)-3-iodo-2-methylprop-2-enyl]-5-oxo-2H-furan-4-yl]-2-methylpent-2-enal |
| SMILES | C/C(=C/I)CC1C=C(CC/C=C(\C)C=O)C(=O)O1 |
| InChI | InChI=1S/C14H17IO3/c1-10(9-16)4-3-5-12-7-13(18-14(12)17)6-11(2)8-15/h4,7-9,13H,3,5-6H2,1-2H3/b10-4+,11-8- |
| InChIKey | XVPTYJVITHIMOB-ZOSRBLQASA-N |
| XLogP | 3.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|