C15H20O4 — CID 163046308
(E)-5-[(2R)-2-[(E)-4-hydroxy-2-methylbut-2-enyl]-5-oxo-2H-furan-4-yl]-2-methylpent-2-enal (PubChem CID 163046308) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (E)-5-[(2R)-2-[(E)-4-hydroxy-2-methylbut-2-enyl]-5-oxo-2H-furan-4-yl]-2-methylpent-2-enal.
| Compound Name | (E)-5-[(2R)-2-[(E)-4-hydroxy-2-methylbut-2-enyl]-5-oxo-2H-furan-4-yl]-2-methylpent-2-enal |
|---|---|
| PubChem CID | 163046308 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (E)-5-[(2R)-2-[(E)-4-hydroxy-2-methylbut-2-enyl]-5-oxo-2H-furan-4-yl]-2-methylpent-2-enal |
| SMILES | C/C(C=O)=C\CCC1=C[C@@H](C/C(C)=C/CO)OC1=O |
| InChI | InChI=1S/C15H20O4/c1-11(6-7-16)8-14-9-13(15(18)19-14)5-3-4-12(2)10-17/h4,6,9-10,14,16H,3,5,7-8H2,1-2H3/b11-6+,12-4+/t14-/m1/s1 |
| InChIKey | KGIWNVMOVZPBAX-CKBZXIAFSA-N |
| XLogP | 2.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|