C11H16O4 — CID 146682548
(5Z)-5-[(2S,3R)-2,3-dihydroxybutylidene]-3-propylfuran-2-one (PubChem CID 146682548) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (5Z)-5-[(2S,3R)-2,3-dihydroxybutylidene]-3-propylfuran-2-one.
| Compound Name | (5Z)-5-[(2S,3R)-2,3-dihydroxybutylidene]-3-propylfuran-2-one |
|---|---|
| PubChem CID | 146682548 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (5Z)-5-[(2S,3R)-2,3-dihydroxybutylidene]-3-propylfuran-2-one |
| SMILES | CCCC1=C/C(=C/[C@H](O)[C@@H](C)O)OC1=O |
| InChI | InChI=1S/C11H16O4/c1-3-4-8-5-9(15-11(8)14)6-10(13)7(2)12/h5-7,10,12-13H,3-4H2,1-2H3/b9-6-/t7-,10+/m1/s1 |
| InChIKey | UBKACRCUIDSXLA-WGZKGSKHSA-N |
| XLogP | 0.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |