C15H12BrNO3 — CID 11359551
methyl 2-(2-bromo-3-pyridinyl)-2,3-dihydro-1-benzofuran-5-carboxylate (PubChem CID 11359551) has the molecular formula C15H12BrNO3 and a molecular weight of 334.17 g/mol. Its IUPAC name is methyl 2-(2-bromo-3-pyridinyl)-2,3-dihydro-1-benzofuran-5-carboxylate.
| Compound Name | methyl 2-(2-bromo-3-pyridinyl)-2,3-dihydro-1-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 11359551 |
| Molecular Formula | C15H12BrNO3 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | methyl 2-(2-bromo-3-pyridinyl)-2,3-dihydro-1-benzofuran-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CC(c1cccnc1Br)O2 |
| InChI | InChI=1S/C15H12BrNO3/c1-19-15(18)9-4-5-12-10(7-9)8-13(20-12)11-3-2-6-17-14(11)16/h2-7,13H,8H2,1H3 |
| InChIKey | GSDKJAJTNBSBJB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|