C21H42OSi2 — CID 11360601
tert-butyl-dimethyl-[(E)-4-methyl-11-trimethylsilylundec-4-en-10-ynoxy]silane (PubChem CID 11360601) has the molecular formula C21H42OSi2 and a molecular weight of 366.74 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-4-methyl-11-trimethylsilylundec-4-en-10-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-4-methyl-11-trimethylsilylundec-4-en-10-ynoxy]silane |
|---|---|
| PubChem CID | 11360601 |
| Molecular Formula | C21H42OSi2 |
| Molecular Weight | 366.74 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-4-methyl-11-trimethylsilylundec-4-en-10-ynoxy]silane |
| SMILES | C/C(=C\CCCCC#C[Si](C)(C)C)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42OSi2/c1-20(16-13-11-10-12-14-19-23(5,6)7)17-15-18-22-24(8,9)21(2,3)4/h16H,10-13,15,17-18H2,1-9H3/b20-16+ |
| InChIKey | ZPBLPHBVTHPFOH-CAPFRKAQSA-N |
| XLogP | 7.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.74 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|