C20H22O3S2 — CID 11360848
(3aR,4S,6aR)-4-[bis(phenylsulfanyl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 11360848) has the molecular formula C20H22O3S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is (3aR,4S,6aR)-4-[bis(phenylsulfanyl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | (3aR,4S,6aR)-4-[bis(phenylsulfanyl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 11360848 |
| Molecular Formula | C20H22O3S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | (3aR,4S,6aR)-4-[bis(phenylsulfanyl)methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2[C@@H](C(Sc3ccccc3)Sc3ccccc3)OC[C@H]2O1 |
| InChI | InChI=1S/C20H22O3S2/c1-20(2)22-16-13-21-18(17(16)23-20)19(24-14-9-5-3-6-10-14)25-15-11-7-4-8-12-15/h3-12,16-19H,13H2,1-2H3/t16-,17-,18+/m1/s1 |
| InChIKey | NACNDHNUGXZWHF-KURKYZTESA-N |
| XLogP | 4.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|