C22H16N4OS — CID 11361117
2-benzylsulfanyl-3-phenyl-[1,2,4]triazolo[5,1-b]quinazolin-9-one (PubChem CID 11361117) has the molecular formula C22H16N4OS and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-benzylsulfanyl-3-phenyl-[1,2,4]triazolo[5,1-b]quinazolin-9-one.
| Compound Name | 2-benzylsulfanyl-3-phenyl-[1,2,4]triazolo[5,1-b]quinazolin-9-one |
|---|---|
| PubChem CID | 11361117 |
| Molecular Formula | C22H16N4OS |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-benzylsulfanyl-3-phenyl-[1,2,4]triazolo[5,1-b]quinazolin-9-one |
| SMILES | O=c1c2ccccc2nc2n(-c3ccccc3)c(SCc3ccccc3)nn12 |
| InChI | InChI=1S/C22H16N4OS/c27-20-18-13-7-8-14-19(18)23-21-25(17-11-5-2-6-12-17)22(24-26(20)21)28-15-16-9-3-1-4-10-16/h1-14H,15H2 |
| InChIKey | ZBAMYOWGTLWOMI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |