C19H26ClN3 — CID 11361729
5-[(tert-butylamino)methyl]-N-(3-chlorophenyl)-4-propan-2-ylpyridin-2-amine (PubChem CID 11361729) has the molecular formula C19H26ClN3 and a molecular weight of 331.89 g/mol. Its IUPAC name is 5-[(tert-butylamino)methyl]-N-(3-chlorophenyl)-4-propan-2-ylpyridin-2-amine.
| Compound Name | 5-[(tert-butylamino)methyl]-N-(3-chlorophenyl)-4-propan-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 11361729 |
| Molecular Formula | C19H26ClN3 |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 5-[(tert-butylamino)methyl]-N-(3-chlorophenyl)-4-propan-2-ylpyridin-2-amine |
| SMILES | CC(C)c1cc(Nc2cccc(Cl)c2)ncc1CNC(C)(C)C |
| InChI | InChI=1S/C19H26ClN3/c1-13(2)17-10-18(23-16-8-6-7-15(20)9-16)21-11-14(17)12-22-19(3,4)5/h6-11,13,22H,12H2,1-5H3,(H,21,23) |
| InChIKey | UJNFERNPUPAMHU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |