About [(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate
[(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate (PubChem CID 11361901) has the molecular formula C18H13BrF2O4
and a molecular weight of 411.20 g/mol. Its IUPAC name is [(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate.
Molecular Properties
| Compound Name | [(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate |
| PubChem CID | 11361901 |
| Molecular Formula | C18H13BrF2O4 |
| Molecular Weight | 411.20 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | [(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate |
| SMILES | C=C(Br)[C@@H](COC(=O)c1ccc(F)cc1)OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H13BrF2O4/c1-11(19)16(25-18(23)13-4-8-15(21)9-5-13)10-24-17(22)12-2-6-14(20)7-3-12/h2-9,16H,1,10H2/t16-/m1/s1 |
| InChIKey | OMDKATOWBZVGJK-MRXNPFEDSA-N |
| XLogP | 4.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.20 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate?
The IUPAC name of [(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate (CID 11361901) is [(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate.
What is the SMILES notation for [(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate?
The canonical SMILES for [(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate is C=C(Br)[C@@H](COC(=O)c1ccc(F)cc1)OC(=O)c1ccc(F)cc1.
What is the InChIKey of [(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate?
The InChIKey is OMDKATOWBZVGJK-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H13BrF2O4/c1-11(19)16(25-18(23)13-4-8-15(21)9-5-13)10-24-17(22)12-2-6-14(20)7-3-12/h2-9,16H,1,10H2/t16-/m1/s1.
What are the key properties of [(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate?
[(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate has a molecular weight of 411.20 g/mol, XLogP of 4.26, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-3-bromo-2-(4-fluorobenzoyl)oxybut-3-enyl] 4-fluorobenzoate is sourced from PubChem (CID 11361901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).