C22H26ClN5O3 — CID 11362763
N-[[1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]methyl]-1H-indazole-3-carboxamide;hydrochloride (PubChem CID 11362763) has the molecular formula C22H26ClN5O3 and a molecular weight of 443.94 g/mol. Its IUPAC name is N-[[1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]methyl]-1H-indazole-3-carboxamide;hydrochloride.
| Compound Name | N-[[1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]methyl]-1H-indazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 11362763 |
| Molecular Formula | C22H26ClN5O3 |
| Molecular Weight | 443.94 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[[1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]methyl]-1H-indazole-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC1CCN(CCc2ccc([N+](=O)[O-])cc2)CC1)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C22H25N5O3.ClH/c28-22(21-19-3-1-2-4-20(19)24-25-21)23-15-17-10-13-26(14-11-17)12-9-16-5-7-18(8-6-16)27(29)30;/h1-8,17H,9-15H2,(H,23,28)(H,24,25);1H |
| InChIKey | NXIFNOXIZSGOIT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.94 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|