About tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane
tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane (PubChem CID 11363468) has the molecular formula C24H50OSn
and a molecular weight of 473.37 g/mol. Its IUPAC name is tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane.
Molecular Properties
| Compound Name | tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane |
| PubChem CID | 11363468 |
| Molecular Formula | C24H50OSn |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane |
| SMILES | CCCCCCCCCC[C@@H]1O[C@H]1[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C12H23O.3C4H9.Sn/c1-2-3-4-5-6-7-8-9-10-12-11-13-12;3*1-3-4-2;/h11-12H,2-10H2,1H3;3*1,3-4H2,2H3;/t12-;;;;/m0..../s1 |
| InChIKey | VBFJQOVIZSPHTM-KCOFNFEMSA-N |
| XLogP | 8.67 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane?
The IUPAC name of tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane (CID 11363468) is tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane.
What is the SMILES notation for tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane?
The canonical SMILES for tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane is CCCCCCCCCC[C@@H]1O[C@H]1[Sn](CCCC)(CCCC)CCCC.
What is the InChIKey of tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane?
The InChIKey is VBFJQOVIZSPHTM-KCOFNFEMSA-N. The full InChI is InChI=1S/C12H23O.3C4H9.Sn/c1-2-3-4-5-6-7-8-9-10-12-11-13-12;3*1-3-4-2;/h11-12H,2-10H2,1H3;3*1,3-4H2,2H3;/t12-;;;;/m0..../s1.
What are the key properties of tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane?
tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane has a molecular weight of 473.37 g/mol, XLogP of 8.67, 19 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[(2S,3S)-3-decyloxiran-2-yl]stannane is sourced from PubChem (CID 11363468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).