C29H60O6Si2 — CID 11365023
(Z,3S,10S,11R)-11,12-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(2-methoxyethoxymethoxy)-10-methyldodec-5-en-2-one (PubChem CID 11365023) has the molecular formula C29H60O6Si2 and a molecular weight of 560.97 g/mol. Its IUPAC name is (Z,3S,10S,11R)-11,12-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(2-methoxyethoxymethoxy)-10-methyldodec-5-en-2-one.
| Compound Name | (Z,3S,10S,11R)-11,12-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(2-methoxyethoxymethoxy)-10-methyldodec-5-en-2-one |
|---|---|
| PubChem CID | 11365023 |
| Molecular Formula | C29H60O6Si2 |
| Molecular Weight | 560.97 g/mol |
| Exact Mass | 560.39 |
| IUPAC Name | (Z,3S,10S,11R)-11,12-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(2-methoxyethoxymethoxy)-10-methyldodec-5-en-2-one |
| SMILES | COCCOCO[C@@H](C/C=C\CCC[C@H](C)[C@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C29H60O6Si2/c1-24(18-16-14-15-17-19-26(25(2)30)33-23-32-21-20-31-9)27(35-37(12,13)29(6,7)8)22-34-36(10,11)28(3,4)5/h15,17,24,26-27H,14,16,18-23H2,1-13H3/b17-15-/t24-,26-,27-/m0/s1 |
| InChIKey | GABUHMZIVFPLQD-YWTQENLYSA-N |
| XLogP | 7.75 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.97 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|