C18H32O5 — CID 102123361
(E,3S,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)undec-5-en-2-one (PubChem CID 102123361) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (E,3S,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)undec-5-en-2-one.
| Compound Name | (E,3S,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)undec-5-en-2-one |
|---|---|
| PubChem CID | 102123361 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (E,3S,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)undec-5-en-2-one |
| SMILES | COCO[C@@H](C/C=C/CCC[C@H](C)[C@@H]1COC(C)(C)O1)C(C)=O |
| InChI | InChI=1S/C18H32O5/c1-14(17-12-22-18(3,4)23-17)10-8-6-7-9-11-16(15(2)19)21-13-20-5/h7,9,14,16-17H,6,8,10-13H2,1-5H3/b9-7+/t14-,16-,17-/m0/s1 |
| InChIKey | YDZAGEKGEQHBGO-MVBLPNKASA-N |
| XLogP | 3.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|