C18H32O5 — CID 134971173
(E,2R)-7-(2-hexyl-1,3-dioxolan-2-yl)-2-(methoxymethoxy)hept-4-enal (PubChem CID 134971173) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (E,2R)-7-(2-hexyl-1,3-dioxolan-2-yl)-2-(methoxymethoxy)hept-4-enal.
| Compound Name | (E,2R)-7-(2-hexyl-1,3-dioxolan-2-yl)-2-(methoxymethoxy)hept-4-enal |
|---|---|
| PubChem CID | 134971173 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (E,2R)-7-(2-hexyl-1,3-dioxolan-2-yl)-2-(methoxymethoxy)hept-4-enal |
| SMILES | CCCCCCC1(CC/C=C/C[C@H](C=O)OCOC)OCCO1 |
| InChI | InChI=1S/C18H32O5/c1-3-4-5-8-11-18(22-13-14-23-18)12-9-6-7-10-17(15-19)21-16-20-2/h6-7,15,17H,3-5,8-14,16H2,1-2H3/b7-6+/t17-/m1/s1 |
| InChIKey | VKAVYNQXDHWSIT-DKRLNXSXSA-N |
| XLogP | 3.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|