C22H40O5 — CID 11731768
(E,2R)-11-(2-hexyl-1,3-dioxolan-2-yl)-2-(methoxymethoxy)undec-4-enal (PubChem CID 11731768) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is (E,2R)-11-(2-hexyl-1,3-dioxolan-2-yl)-2-(methoxymethoxy)undec-4-enal.
| Compound Name | (E,2R)-11-(2-hexyl-1,3-dioxolan-2-yl)-2-(methoxymethoxy)undec-4-enal |
|---|---|
| PubChem CID | 11731768 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | (E,2R)-11-(2-hexyl-1,3-dioxolan-2-yl)-2-(methoxymethoxy)undec-4-enal |
| SMILES | CCCCCCC1(CCCCCC/C=C/C[C@H](C=O)OCOC)OCCO1 |
| InChI | InChI=1S/C22H40O5/c1-3-4-5-12-15-22(26-17-18-27-22)16-13-10-8-6-7-9-11-14-21(19-23)25-20-24-2/h9,11,19,21H,3-8,10,12-18,20H2,1-2H3/b11-9+/t21-/m1/s1 |
| InChIKey | QDHWMGWCSPUCKD-FKVRIVCVSA-N |
| XLogP | 5.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|