C16H28O3 — CID 178179083
(4R,5S)-5-[(E)-dec-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 178179083) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is (4R,5S)-5-[(E)-dec-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4R,5S)-5-[(E)-dec-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 178179083 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | (4R,5S)-5-[(E)-dec-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CCCCCCC/C=C/C[C@@H]1OC(C)(C)O[C@H]1C=O |
| InChI | InChI=1S/C16H28O3/c1-4-5-6-7-8-9-10-11-12-14-15(13-17)19-16(2,3)18-14/h10-11,13-15H,4-9,12H2,1-3H3/b11-10+/t14-,15-/m0/s1 |
| InChIKey | YFNGXYWZLXWAHH-BWLFODOESA-N |
| XLogP | 4.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|