C18H32O3 — CID 10613893
(4S,5S)-5-[(E)-dodec-1-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 10613893) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is (4S,5S)-5-[(E)-dodec-1-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4S,5S)-5-[(E)-dodec-1-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 10613893 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | (4S,5S)-5-[(E)-dodec-1-enyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CCCCCCCCCC/C=C/[C@@H]1OC(C)(C)O[C@@H]1C=O |
| InChI | InChI=1S/C18H32O3/c1-4-5-6-7-8-9-10-11-12-13-14-16-17(15-19)21-18(2,3)20-16/h13-17H,4-12H2,1-3H3/b14-13+/t16-,17+/m0/s1 |
| InChIKey | CQGAEGWUJHCRNC-LHMZYYNSSA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|