C16H28O4 — CID 101192894
(E,3S,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyundec-5-en-2-one (PubChem CID 101192894) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (E,3S,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyundec-5-en-2-one.
| Compound Name | (E,3S,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyundec-5-en-2-one |
|---|---|
| PubChem CID | 101192894 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (E,3S,10S)-10-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxyundec-5-en-2-one |
| SMILES | CC(=O)[C@@H](O)C/C=C/CCC[C@H](C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H28O4/c1-12(15-11-19-16(3,4)20-15)9-7-5-6-8-10-14(18)13(2)17/h6,8,12,14-15,18H,5,7,9-11H2,1-4H3/b8-6+/t12-,14-,15-/m0/s1 |
| InChIKey | NOYQCBIHYNHYCP-PSDCYKOWSA-N |
| XLogP | 2.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|