C17H30O4 — CID 134929618
(E,5R,10R)-11-(1,3-dioxolan-2-yl)-5-hydroxy-2,6,10-trimethylundec-6-en-4-one (PubChem CID 134929618) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is (E,5R,10R)-11-(1,3-dioxolan-2-yl)-5-hydroxy-2,6,10-trimethylundec-6-en-4-one.
| Compound Name | (E,5R,10R)-11-(1,3-dioxolan-2-yl)-5-hydroxy-2,6,10-trimethylundec-6-en-4-one |
|---|---|
| PubChem CID | 134929618 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (E,5R,10R)-11-(1,3-dioxolan-2-yl)-5-hydroxy-2,6,10-trimethylundec-6-en-4-one |
| SMILES | C/C(=C\CC[C@@H](C)CC1OCCO1)[C@@H](O)C(=O)CC(C)C |
| InChI | InChI=1S/C17H30O4/c1-12(2)10-15(18)17(19)14(4)7-5-6-13(3)11-16-20-8-9-21-16/h7,12-13,16-17,19H,5-6,8-11H2,1-4H3/b14-7+/t13-,17-/m1/s1 |
| InChIKey | QXVKKLKCWCMYFL-ARJFVOGHSA-N |
| XLogP | 3.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|