C31H55NO6Si2 — CID 11365373
(4R)-4-benzyl-3-[(2R,3S,5S,6R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,6-dimethylheptanoyl]-1,3-oxazolidin-2-one (PubChem CID 11365373) has the molecular formula C31H55NO6Si2 and a molecular weight of 593.95 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S,5S,6R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,6-dimethylheptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S,5S,6R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,6-dimethylheptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11365373 |
| Molecular Formula | C31H55NO6Si2 |
| Molecular Weight | 593.95 g/mol |
| Exact Mass | 593.36 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S,5S,6R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-2,6-dimethylheptanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](C[C@H](O)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H55NO6Si2/c1-22(20-37-39(9,10)30(3,4)5)27(38-40(11,12)31(6,7)8)19-26(33)23(2)28(34)32-25(21-36-29(32)35)18-24-16-14-13-15-17-24/h13-17,22-23,25-27,33H,18-21H2,1-12H3/t22-,23-,25-,26+,27+/m1/s1 |
| InChIKey | RHQARKIECJVPRJ-LAWNVLIOSA-N |
| XLogP | 7.01 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.95 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|