C39H38N2O4 — CID 11365419
N-[2-(3-methoxyphenyl)ethyl]-N-[[4-[4-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 11365419) has the molecular formula C39H38N2O4 and a molecular weight of 598.74 g/mol. Its IUPAC name is N-[2-(3-methoxyphenyl)ethyl]-N-[[4-[4-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-(3-methoxyphenyl)ethyl]-N-[[4-[4-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 11365419 |
| Molecular Formula | C39H38N2O4 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | N-[2-(3-methoxyphenyl)ethyl]-N-[[4-[4-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1cccc(CCN(Cc2ccc(-c3ccc(CNCCc4ccccc4)cc3)cc2)C(=O)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C39H38N2O4/c1-43-36-9-5-8-30(24-36)21-23-41(39(42)35-18-19-37-38(25-35)45-28-44-37)27-32-12-16-34(17-13-32)33-14-10-31(11-15-33)26-40-22-20-29-6-3-2-4-7-29/h2-19,24-25,40H,20-23,26-28H2,1H3 |
| InChIKey | VSGSICNFEAFWON-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|