C6H13N2+ — CID 11366974
1-methyl-4-methylidene-(5,6-13C2)1,4-diazinan-4-ium (PubChem CID 11366974) has the molecular formula C6H13N2+ and a molecular weight of 115.17 g/mol. Its IUPAC name is 1-methyl-4-methylidene-(5,6-13C2)1,4-diazinan-4-ium.
| Compound Name | 1-methyl-4-methylidene-(5,6-13C2)1,4-diazinan-4-ium |
|---|---|
| PubChem CID | 11366974 |
| Molecular Formula | C6H13N2+ |
| Molecular Weight | 115.17 g/mol |
| Exact Mass | 115.11 |
| IUPAC Name | 1-methyl-4-methylidene-(5,6-13C2)1,4-diazinan-4-ium |
| SMILES | C=[N+]1CCN(C)[13CH2][13CH2]1 |
| InChI | InChI=1S/C6H13N2/c1-7-3-5-8(2)6-4-7/h1,3-6H2,2H3/q+1/i3+1,5+1 |
| InChIKey | BILHIRMFAGMAJG-ZIEKVONGSA-N |
| XLogP | -0.36 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.17 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|