C8H20N2S — CID 11367311
N'-(2-propan-2-ylsulfanylethyl)propane-1,3-diamine (PubChem CID 11367311) has the molecular formula C8H20N2S and a molecular weight of 176.33 g/mol. Its IUPAC name is N'-(2-propan-2-ylsulfanylethyl)propane-1,3-diamine.
| Compound Name | N'-(2-propan-2-ylsulfanylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 11367311 |
| Molecular Formula | C8H20N2S |
| Molecular Weight | 176.33 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N'-(2-propan-2-ylsulfanylethyl)propane-1,3-diamine |
| SMILES | CC(C)SCCNCCCN |
| InChI | InChI=1S/C8H20N2S/c1-8(2)11-7-6-10-5-3-4-9/h8,10H,3-7,9H2,1-2H3 |
| InChIKey | GZJFUXQTINCOSI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|