C11H18O2 — CID 11367389
3-(cyclohexylmethyl)-3,6-dihydro-1,2-dioxine (PubChem CID 11367389) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-3,6-dihydro-1,2-dioxine.
| Compound Name | 3-(cyclohexylmethyl)-3,6-dihydro-1,2-dioxine |
|---|---|
| PubChem CID | 11367389 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 3-(cyclohexylmethyl)-3,6-dihydro-1,2-dioxine |
| SMILES | C1=CC(CC2CCCCC2)OOC1 |
| InChI | InChI=1S/C11H18O2/c1-2-5-10(6-3-1)9-11-7-4-8-12-13-11/h4,7,10-11H,1-3,5-6,8-9H2 |
| InChIKey | LNLOAPSDHMSSHX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|