C17H13N3O3 — CID 11370244
ethyl 6-cyano-2-formyl-5-methylimidazo[2,1-a]isoquinoline-3-carboxylate (PubChem CID 11370244) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is ethyl 6-cyano-2-formyl-5-methylimidazo[2,1-a]isoquinoline-3-carboxylate.
| Compound Name | ethyl 6-cyano-2-formyl-5-methylimidazo[2,1-a]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 11370244 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | ethyl 6-cyano-2-formyl-5-methylimidazo[2,1-a]isoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(C=O)nc2c3ccccc3c(C#N)c(C)n12 |
| InChI | InChI=1S/C17H13N3O3/c1-3-23-17(22)15-14(9-21)19-16-12-7-5-4-6-11(12)13(8-18)10(2)20(15)16/h4-7,9H,3H2,1-2H3 |
| InChIKey | STORGTOTNPWSMC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|