C21H15N3O2 — CID 122225994
ethyl 4-cyano-1-phenylpyrido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 122225994) has the molecular formula C21H15N3O2 and a molecular weight of 341.37 g/mol. Its IUPAC name is ethyl 4-cyano-1-phenylpyrido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl 4-cyano-1-phenylpyrido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 122225994 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | ethyl 4-cyano-1-phenylpyrido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)n2c(nc3ccccc32)c1C#N |
| InChI | InChI=1S/C21H15N3O2/c1-2-26-21(25)15-12-19(14-8-4-3-5-9-14)24-18-11-7-6-10-17(18)23-20(24)16(15)13-22/h3-12H,2H2,1H3 |
| InChIKey | XVWDYVWPXSNDPH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |