C16H30O4Si — CID 11370453
(4aR,6S,7R,8aS)-2,2-ditert-butyl-6-ethenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol (PubChem CID 11370453) has the molecular formula C16H30O4Si and a molecular weight of 314.50 g/mol. Its IUPAC name is (4aR,6S,7R,8aS)-2,2-ditert-butyl-6-ethenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol.
| Compound Name | (4aR,6S,7R,8aS)-2,2-ditert-butyl-6-ethenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol |
|---|---|
| PubChem CID | 11370453 |
| Molecular Formula | C16H30O4Si |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (4aR,6S,7R,8aS)-2,2-ditert-butyl-6-ethenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol |
| SMILES | C=C[C@@H]1O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C16H30O4Si/c1-8-12-11(17)9-13-14(19-12)10-18-21(20-13,15(2,3)4)16(5,6)7/h8,11-14,17H,1,9-10H2,2-7H3/t11-,12+,13+,14-/m1/s1 |
| InChIKey | TUGJDGZGCPKJPV-ZOBORPQBSA-N |
| XLogP | 3.15 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|