C23H21NO3 — CID 11371814
ethyl 6-(2,2-diphenylethenoxymethyl)pyridine-3-carboxylate (PubChem CID 11371814) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is ethyl 6-(2,2-diphenylethenoxymethyl)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(2,2-diphenylethenoxymethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 11371814 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | ethyl 6-(2,2-diphenylethenoxymethyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(COC=C(c2ccccc2)c2ccccc2)nc1 |
| InChI | InChI=1S/C23H21NO3/c1-2-27-23(25)20-13-14-21(24-15-20)16-26-17-22(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15,17H,2,16H2,1H3 |
| InChIKey | SQKODQOOWMNQFU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|