C20H25NO4S — CID 11372282
methyl (1S,3aE,6Z,9aS)-4-methyl-2-(4-methylphenyl)sulfonyl-1,3,5,8,9,9a-hexahydrocycloocta[c]pyrrole-1-carboxylate (PubChem CID 11372282) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is methyl (1S,3aE,6Z,9aS)-4-methyl-2-(4-methylphenyl)sulfonyl-1,3,5,8,9,9a-hexahydrocycloocta[c]pyrrole-1-carboxylate.
| Compound Name | methyl (1S,3aE,6Z,9aS)-4-methyl-2-(4-methylphenyl)sulfonyl-1,3,5,8,9,9a-hexahydrocycloocta[c]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 11372282 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | methyl (1S,3aE,6Z,9aS)-4-methyl-2-(4-methylphenyl)sulfonyl-1,3,5,8,9,9a-hexahydrocycloocta[c]pyrrole-1-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2CC/C=C\C/C(C)=C\2CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H25NO4S/c1-14-9-11-16(12-10-14)26(23,24)21-13-18-15(2)7-5-4-6-8-17(18)19(21)20(22)25-3/h4-5,9-12,17,19H,6-8,13H2,1-3H3/b5-4-,18-15-/t17-,19-/m0/s1 |
| InChIKey | MWWWJYLFUQKHML-NITTWRNKSA-N |
| XLogP | 3.21 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|