C21H19CuNO2 — CID 11372377
copper;(6Z)-6-[[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one (PubChem CID 11372377) has the molecular formula C21H19CuNO2 and a molecular weight of 380.93 g/mol. Its IUPAC name is copper;(6Z)-6-[[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | copper;(6Z)-6-[[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 11372377 |
| Molecular Formula | C21H19CuNO2 |
| Molecular Weight | 380.93 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | copper;(6Z)-6-[[[(1S,2R)-2-hydroxy-1,2-diphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=C/C1=C/N[C@@H](c1ccccc1)[C@H](O)c1ccccc1.[Cu] |
| InChI | InChI=1S/C21H19NO2.Cu/c23-19-14-8-7-13-18(19)15-22-20(16-9-3-1-4-10-16)21(24)17-11-5-2-6-12-17;/h1-15,20-22,24H;/b18-15-;/t20-,21+;/m0./s1 |
| InChIKey | SCLQUXSIKAEEIZ-ANUOSDKJSA-N |
| XLogP | 3.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.93 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|