C14H13FIN3O2 — CID 11372988
4-(2-fluoro-4-iodoanilino)-N,1-dimethyl-6-oxopyridine-3-carboxamide (PubChem CID 11372988) has the molecular formula C14H13FIN3O2 and a molecular weight of 401.18 g/mol. Its IUPAC name is 4-(2-fluoro-4-iodoanilino)-N,1-dimethyl-6-oxopyridine-3-carboxamide.
| Compound Name | 4-(2-fluoro-4-iodoanilino)-N,1-dimethyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 11372988 |
| Molecular Formula | C14H13FIN3O2 |
| Molecular Weight | 401.18 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 4-(2-fluoro-4-iodoanilino)-N,1-dimethyl-6-oxopyridine-3-carboxamide |
| SMILES | CNC(=O)c1cn(C)c(=O)cc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C14H13FIN3O2/c1-17-14(21)9-7-19(2)13(20)6-12(9)18-11-4-3-8(16)5-10(11)15/h3-7,18H,1-2H3,(H,17,21) |
| InChIKey | GHWGOWZXFSETFX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|