C14H22Si — CID 11378985
trimethyl-[(Z)-undec-6-en-1,4-diynyl]silane (PubChem CID 11378985) has the molecular formula C14H22Si and a molecular weight of 218.42 g/mol. Its IUPAC name is trimethyl-[(Z)-undec-6-en-1,4-diynyl]silane.
| Compound Name | trimethyl-[(Z)-undec-6-en-1,4-diynyl]silane |
|---|---|
| PubChem CID | 11378985 |
| Molecular Formula | C14H22Si |
| Molecular Weight | 218.42 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | trimethyl-[(Z)-undec-6-en-1,4-diynyl]silane |
| SMILES | CCCC/C=C\C#CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C14H22Si/c1-5-6-7-8-9-10-11-12-13-14-15(2,3)4/h8-9H,5-7,12H2,1-4H3/b9-8- |
| InChIKey | QTDUTHQUFHTRKC-HJWRWDBZSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|