C13H20O4 — CID 11379465
ethyl (3S,3aR)-3-methoxy-3,3a,4,5,6,7-hexahydro-2H-cyclohepta[b]furan-8-carboxylate (PubChem CID 11379465) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is ethyl (3S,3aR)-3-methoxy-3,3a,4,5,6,7-hexahydro-2H-cyclohepta[b]furan-8-carboxylate.
| Compound Name | ethyl (3S,3aR)-3-methoxy-3,3a,4,5,6,7-hexahydro-2H-cyclohepta[b]furan-8-carboxylate |
|---|---|
| PubChem CID | 11379465 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | ethyl (3S,3aR)-3-methoxy-3,3a,4,5,6,7-hexahydro-2H-cyclohepta[b]furan-8-carboxylate |
| SMILES | CCOC(=O)C1=C2OC[C@@H](OC)[C@H]2CCCC1 |
| InChI | InChI=1S/C13H20O4/c1-3-16-13(14)10-7-5-4-6-9-11(15-2)8-17-12(9)10/h9,11H,3-8H2,1-2H3/t9-,11-/m1/s1 |
| InChIKey | GTUGTPBOPWNZGY-MWLCHTKSSA-N |
| XLogP | 2.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |