C18H30O4 — CID 11266900
ethyl (3R,3aR,13E)-3-methoxy-2,3,3a,4,5,6,7,8,9,10,11,12-dodecahydrocyclododeca[b]furan-13-carboxylate (PubChem CID 11266900) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is ethyl (3R,3aR,13E)-3-methoxy-2,3,3a,4,5,6,7,8,9,10,11,12-dodecahydrocyclododeca[b]furan-13-carboxylate.
| Compound Name | ethyl (3R,3aR,13E)-3-methoxy-2,3,3a,4,5,6,7,8,9,10,11,12-dodecahydrocyclododeca[b]furan-13-carboxylate |
|---|---|
| PubChem CID | 11266900 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | ethyl (3R,3aR,13E)-3-methoxy-2,3,3a,4,5,6,7,8,9,10,11,12-dodecahydrocyclododeca[b]furan-13-carboxylate |
| SMILES | CCOC(=O)/C1=C2/OC[C@H](OC)[C@H]2CCCCCCCCC1 |
| InChI | InChI=1S/C18H30O4/c1-3-21-18(19)15-12-10-8-6-4-5-7-9-11-14-16(20-2)13-22-17(14)15/h14,16H,3-13H2,1-2H3/b17-15+/t14-,16+/m1/s1 |
| InChIKey | HJJREVOKQBKMEX-CTLGNIDLSA-N |
| XLogP | 3.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |