C20H30O5 — CID 134941337
diethyl 5-hexyl-1,3,5,6-tetrahydro-2-benzofuran-4,7-dicarboxylate (PubChem CID 134941337) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is diethyl 5-hexyl-1,3,5,6-tetrahydro-2-benzofuran-4,7-dicarboxylate.
| Compound Name | diethyl 5-hexyl-1,3,5,6-tetrahydro-2-benzofuran-4,7-dicarboxylate |
|---|---|
| PubChem CID | 134941337 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | diethyl 5-hexyl-1,3,5,6-tetrahydro-2-benzofuran-4,7-dicarboxylate |
| SMILES | CCCCCCC1CC(C(=O)OCC)=C2COCC2=C1C(=O)OCC |
| InChI | InChI=1S/C20H30O5/c1-4-7-8-9-10-14-11-15(19(21)24-5-2)16-12-23-13-17(16)18(14)20(22)25-6-3/h14H,4-13H2,1-3H3 |
| InChIKey | BITGJEGNAKCZFO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|