C15H25NO2 — CID 11379738
(5S,6S,7R,8R,8aS)-6-ethenyl-8-ethyl-7-hydroxy-5-propyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 11379738) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is (5S,6S,7R,8R,8aS)-6-ethenyl-8-ethyl-7-hydroxy-5-propyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (5S,6S,7R,8R,8aS)-6-ethenyl-8-ethyl-7-hydroxy-5-propyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 11379738 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (5S,6S,7R,8R,8aS)-6-ethenyl-8-ethyl-7-hydroxy-5-propyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | C=C[C@@H]1[C@H](O)[C@H](CC)[C@@H]2CCC(=O)N2[C@H]1CCC |
| InChI | InChI=1S/C15H25NO2/c1-4-7-12-10(5-2)15(18)11(6-3)13-8-9-14(17)16(12)13/h5,10-13,15,18H,2,4,6-9H2,1,3H3/t10-,11+,12-,13-,15-/m0/s1 |
| InChIKey | HKTMNQWFNGFCRY-KBRXKUPHSA-N |
| XLogP | 2.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|